![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Alkylation of Amines..> | 2014-10-21 15:53 | 138K | |
| Amines via Hofmann, ..> | 2014-10-21 15:53 | 1.6M | |
| Hofmann/ | 2025-03-17 14:34 | - | |
| The Chemistry of Hyd..> | 2014-10-21 15:53 | 962K | |
| The Hydroxamic Acids..> | 2014-10-21 15:52 | 2.3M | |
| The Reaction of Oxal..> | 2014-10-21 15:52 | 581K | |
| The Reaction of Oxal..> | 2014-10-21 15:52 | 835K | |
| lossen.gif | 2014-10-21 15:52 | 1.3K | |
| mech.JPG | 2014-10-21 15:52 | 5.5K | |
