![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Journal of Chemical ..> | 2025-03-17 14:35 | - | |
| Lab Equipment and Su..> | 2025-03-17 14:35 | - | |
| Lost File Results/ | 2024-06-14 21:58 | - | |
| MISC/ | 2025-03-17 14:35 | - | |
| NEW/ | 2025-03-17 14:35 | - | |
| Nuclear Science/ | 2025-03-17 14:35 | - | |
| Organic Synthesis/ | 2025-03-17 14:35 | - | |
| Pharmacology/ | 2025-03-17 14:35 | - | |
| Private/ | 2025-03-17 14:35 | - | |
| Safety/ | 2025-03-17 14:35 | - | |
| Software and Calcula..> | 2025-03-17 14:36 | - | |
| Solvents/ | 2025-03-17 14:36 | - | |
| Synthesis/ | 2025-03-17 14:36 | - | |
| web/ | 2025-03-17 14:36 | - | |